For research use only. Not for therapeutic Use.
3-(4-Chlorophenyl)propan-1-ol(Cat No.:L016495)is an organic compound used as an intermediate in the synthesis of pharmaceuticals and fine chemicals. The molecule features a chlorinated phenyl ring attached to a propanol chain, providing unique reactivity and versatility in various chemical reactions. It is particularly useful in the development of biologically active molecules, where the chlorophenyl group can enhance interactions with biological targets. This compound is valuable for creating complex molecular structures in medicinal chemistry, making it an essential building block for researchers in drug discovery and advanced organic synthesis.
CAS Number | 6282-88-8 |
Molecular Formula | C9H11ClO |
Purity | ≥95% |
IUPAC Name | 3-(4-chlorophenyl)propan-1-ol |
InChI | InChI=1S/C9H11ClO/c10-9-5-3-8(4-6-9)2-1-7-11/h3-6,11H,1-2,7H2 |
InChIKey | ZHBIWFGGIKFSHZ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CCCO)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |