For research use only. Not for therapeutic Use.
3-[4-(Dimethylamino)phenyl]propanoic acid(CAT: L015207) is a high-purity aromatic carboxylic acid widely utilized as an intermediate in pharmaceutical and chemical research. Featuring a dimethylamino-substituted phenyl ring and a propanoic acid group, this compound offers versatility for targeted modifications in the synthesis of bioactive molecules, dyes, and advanced materials. Its well-defined structure allows for applications in medicinal chemistry, where it serves as a key building block for drug candidates and functionalized frameworks. With excellent stability and reactivity, 3-[4-(Dimethylamino)phenyl]propanoic acid supports innovative chemical transformations, enabling the development of precision-driven solutions in synthetic organic chemistry and material science.
CAS Number | 73718-09-9 |
Molecular Formula | C11H15NO2 |
Purity | ≥95% |
IUPAC Name | 3-[4-(dimethylamino)phenyl]propanoic acid |
InChI | InChI=1S/C11H15NO2/c1-12(2)10-6-3-9(4-7-10)5-8-11(13)14/h3-4,6-7H,5,8H2,1-2H3,(H,13,14) |
InChIKey | YEETZXRKMHAPRM-UHFFFAOYSA-N |
SMILES | CN(C)C1=CC=C(C=C1)CCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |