Home
>
Isotope Labeled Compounds>Other Isotope Labeled Compounds> 3-[(4-Fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanoic Acid-d4
For research use only. Not for therapeutic Use.
3-[(4-Fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanoic Acid-d4(Cat No.:R028254) is a high-purity deuterated compound crucial for advanced pharmaceutical and biochemical research. This isotopically labeled version, featuring four deuterium atoms, is essential for detailed studies of metabolic pathways, drug development, and structural analysis. Its robust isotope labeling ensures precise and reliable analytical results, making it suitable for various experimental setups.
CAS Number | NA |
Synonyms | Bicalutamide EP Impurity M-d4 |
Molecular Formula | C₁₀H₇D₄FO₅S |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | 2-hydroxy-2-methyl-3-(2,3,5,6-tetradeuterio-4-fluorophenyl)sulfonylpropanoic acid |
InChI | InChI=1S/C10H11FO5S/c1-10(14,9(12)13)6-17(15,16)8-4-2-7(11)3-5-8/h2-5,14H,6H2,1H3,(H,12,13)/i2D,3D,4D,5D |
InChIKey | DSXJLPDNNPNIRF-QFFDRWTDSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1F)[2H])[2H])S(=O)(=O)CC(C)(C(=O)O)O)[2H] |