For research use only. Not for therapeutic Use.
3-{[(4-Fluorophenyl)methyl]amino}(Cat No.:L007472), represents a chemical structure with a substituted amino group attached to a phenyl ring. This molecule has potential applications in medicinal chemistry and drug development due to its specific arrangement of atoms, which influences its biological interactions. Researchers explore its pharmacological properties to understand its potential as a therapeutic agent, often focusing on its interactions with biological targets. By studying this compound’s behavior, scientists aim to design novel medications, potentially contributing to the development of treatments for various diseases or conditions.
CAS Number | 1042534-72-4 |
Molecular Formula | C14H13FN2O |
Purity | ≥95% |
IUPAC Name | 3-[(4-fluorophenyl)methylamino]benzamide |
InChI | InChI=1S/C14H13FN2O/c15-12-6-4-10(5-7-12)9-17-13-3-1-2-11(8-13)14(16)18/h1-8,17H,9H2,(H2,16,18) |
InChIKey | MUJUVCOIMMGFNB-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)NCC2=CC=C(C=C2)F)C(=O)N |