For research use only. Not for therapeutic Use.
3-(4-Hydroxybutyl)-1H-indole-5-carbonitrile (Cat No.:C000793) is a chemical compound composed of an indole ring system with a hydroxy butyl side chain and a carbonitrile functional group. This unique structure suggests potential applications in medicinal chemistry or organic synthesis. Researchers may explore its reactivity, potential biological activities, and interactions. Investigations into its properties could lead to the development of novel molecules with specific pharmacological effects or potential therapeutic applications.
CAS Number | 914927-40-5 |
Molecular Formula | C₁₃H₁₄N₂O |
Purity | ≥95% |
Solubility | DMSO (Slightly), Methanol (Slightly) |
Appearance | White to Off-White Solid |
Storage | 2-8°C, Inert atmosphere |
IUPAC Name | 3-(4-hydroxybutyl)-1H-indole-5-carbonitrile |
InChI | InChI=1S/C13H14N2O/c14-8-10-4-5-13-12(7-10)11(9-15-13)3-1-2-6-16/h4-5,7,9,15-16H,1-3,6H2 |
InChIKey | BZXNEONCFZGWDS-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1C#N)C(=CN2)CCCCO |
Reference | Bartoszyk, G., et al.: Eur. J. Pharmacol., 322, 147 (1997); Heinrich, T., et al.: J. Med. Chem., 47, 4684 (2004) |