For research use only. Not for therapeutic Use.
3-(4’-Hydroxyphenyl)propionic Acid-OSu is a high-purity compound essential for advanced pharmaceutical and biochemical research. This NHS ester derivative is crucial for studies involving protein labeling, cross-linking, and organic synthesis. Known for its stability and reactivity with amine groups, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
CAS Number | 34071-95-9 |
Synonyms | N-[(p-Hydroxyhydrocinnamoyl)oxy]-succinimide; 3-(4-Hydroxyphenyl)propionic Acid N-hydroxysuccinimide Ester; N-Succinimidyl 3-(4-Hydroxyphenyl)propionate; NSC 240876; Bolton-Hunter Precursor; Rudinger Reagent; |
Molecular Formula | C13H13NO5 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-(4-hydroxyphenyl)propanoate |
InChI | InChI=1S/C13H13NO5/c15-10-4-1-9(2-5-10)3-8-13(18)19-14-11(16)6-7-12(14)17/h1-2,4-5,15H,3,6-8H2 |
InChIKey | KYRUKRFVOACELK-UHFFFAOYSA-N |
SMILES | C1CC(=O)N(C1=O)OC(=O)CCC2=CC=C(C=C2)O |