For research use only. Not for therapeutic Use.
3-(4-Hydroxyphenyl)propionic Acid(Cat No.:R008262) is a simple organic compound characterized by a phenolic group attached to a propionic acid moiety. Its mode of action and pharmacological effects may involve its interactions with biochemical pathways and cellular processes due to its structural features. While specific pharmacologic actions and applications for this compound are not extensively documented, it could serve as a precursor or intermediate in various chemical syntheses. Compounds like 3-(4-Hydroxyphenyl)propionic Acid are important building blocks in organic synthesis, potentially contributing to the creation of more complex molecules for pharmaceuticals, agrochemicals, or other specialized uses
CAS Number | 501-97-3 |
Synonyms | 4-Hydroxy-benzenepropanoic Acid; p-Hydroxyhydrocinnamic Acid; 2,3-Dihydro-p-coumaric Acid; 4-(2-Carboxyethyl)phenol; Desaminotyrosine; 4-Hydroxybenzenepropanoic Acid;NSC 40949; NSC 65596; |
Molecular Formula | C9H10O3 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | -20°C |
IUPAC Name | 3-(4-hydroxyphenyl)propanoic acid |
InChI | InChI=1S/C9H10O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5,10H,3,6H2,(H,11,12) |
InChIKey | NMHMNPHRMNGLLB-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CCC(=O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |