For research use only. Not for therapeutic Use.
3-(4-Methoxybenzoyl)propionic acid(CAT: L046276) is an aromatic keto acid featuring a methoxy-substituted benzoyl group attached to a propionic acid chain. This compound serves as a valuable intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Its structure allows for easy modifications, making it ideal for synthesizing complex molecules, especially those targeting enzyme inhibition or receptor binding studies in medicinal chemistry. 3-(4-Methoxybenzoyl)propionic acid provides versatility and stability, making it a useful component for researchers focused on developing bioactive molecules and optimizing synthetic pathways.
CAS Number | 3153-44-4 |
Molecular Formula | C11H12O4 |
Purity | ≥95% |
IUPAC Name | 4-(4-methoxyphenyl)-4-oxobutanoic acid |
InChI | InChI=1S/C11H12O4/c1-15-9-4-2-8(3-5-9)10(12)6-7-11(13)14/h2-5H,6-7H2,1H3,(H,13,14) |
InChIKey | OMTDIBZSUZNVJK-UHFFFAOYSA-N |