For research use only. Not for therapeutic Use.
3-((4-Methoxybenzyl)oxy)propan-1-ol(Cat No.:L026087)is an organic compound featuring a 4-methoxybenzyl group attached to a propanol backbone via an ether linkage. This compound is widely used in pharmaceutical and chemical research as a versatile intermediate in the synthesis of bioactive molecules and fine chemicals. Its structure allows for various chemical modifications, making it valuable in the development of complex organic compounds, including potential drug candidates. 3-((4-Methoxybenzyl)oxy)propan-1-ol is essential for researchers focused on innovative synthetic methodologies and medicinal chemistry.
CAS Number | 135362-69-5 |
Molecular Formula | C11H16O3 |
Purity | ≥95% |
IUPAC Name | 3-[(4-methoxyphenyl)methoxy]propan-1-ol |
InChI | InChI=1S/C11H16O3/c1-13-11-5-3-10(4-6-11)9-14-8-2-7-12/h3-6,12H,2,7-9H2,1H3 |
InChIKey | BGEHPNIXVMWYJD-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)COCCCO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |