For research use only. Not for therapeutic Use.
3-(4-methyl-1H-pyrazol-1-yl)benzoic acid(CAT: L000395) is a chemical compound with potential applications in both pharmaceutical and organic chemistry. This compound can serve as an intermediate for the synthesis of various organic molecules, particularly those with potential pharmaceutical applications. In pharmaceutical chemistry, it plays a pivotal role in the creation of novel drug candidates, as it contains a pyrazole moiety, which is a valuable pharmacophore often found in drug design.
CAS Number | 1251072-11-3 |
Molecular Formula | C11H10N2O2 |
Purity | ≥95% |
IUPAC Name | 3-(4-methylpyrazol-1-yl)benzoic acid |
InChI | InChI=1S/C11H10N2O2/c1-8-6-12-13(7-8)10-4-2-3-9(5-10)11(14)15/h2-7H,1H3,(H,14,15) |
InChIKey | HLSKPIKSWVNKQZ-UHFFFAOYSA-N |