Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3-(4-Methylphenyl)-3-oxetanamine hydrochloride
For research use only. Not for therapeutic Use.
3-(4-Methylphenyl)-3-oxetanamine hydrochloride(Cat No.:L027449)is an organic compound used in pharmaceutical and chemical research. This molecule features an oxetane ring with a 4-methylphenyl group and an amine group, existing as a hydrochloride salt for enhanced stability and solubility. It is a valuable intermediate in the synthesis of bioactive compounds, including potential drug candidates. The combination of the oxetane ring and aromatic moiety imparts unique reactivity, making it useful in the development of novel therapeutic agents. This compound supports advanced research in medicinal chemistry and drug discovery.
CAS Number | 1322200-77-0 |
Molecular Formula | C10H14ClNO |
Purity | ≥95% |
IUPAC Name | 3-(4-methylphenyl)oxetan-3-amine;hydrochloride |
InChI | InChI=1S/C10H13NO.ClH/c1-8-2-4-9(5-3-8)10(11)6-12-7-10;/h2-5H,6-7,11H2,1H3;1H |
InChIKey | UKNASRDBASHMNC-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)C2(COC2)N.Cl |