For research use only. Not for therapeutic Use.
3-(4-Morpholinyl)aniline(CAT: M039072) is an aromatic amine with a morpholine ring substitution, commonly utilized in pharmaceutical research as a versatile intermediate for synthesizing bioactive compounds. The combination of an aniline and a morpholine group provides polarity and the ability to form hydrogen bonds, making it suitable for creating molecules that interact with enzymes, receptors, or ion channels. This structure is particularly useful in medicinal chemistry for developing compounds aimed at treating neurological disorders, cancer, and inflammation. 3-(4-Morpholinyl)aniline serves as a valuable building block in designing drug candidates and optimizing pharmacokinetic properties in drug discovery.
CAS Number | 159724-40-0 |
Molecular Formula | C10H14N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-morpholin-4-ylaniline |
InChI | InChI=1S/C10H14N2O/c11-9-2-1-3-10(8-9)12-4-6-13-7-5-12/h1-3,8H,4-7,11H2 |
InChIKey | ZJWLMZURLIHVHE-UHFFFAOYSA-N |
SMILES | C1COCCN1C2=CC(=CC=C2)N |