3-(4-Phenylphenoxy)propanoic acid

• CAT Number: L007353
• CAS Number: 63472-21-9
• Molecular Formula: C15H14O3
• Molecular Weight: 242.27
• Purity: ≥95%
• IUPAC Name: 3-(4-phenylphenoxy)propanoic acid
• InChI: InChI=1S/C15H14O3/c16-15(17)10-11-18-14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,16,17)
• InChIKey: SJVZXSPIOGTQLX-UHFFFAOYSA-N
• SMILES: C1=CC=C(C=C1)C2=CC=C(C=C2)OCCC(=O)O

3-(4-Phenylphenoxy)propanoic acid（Cat No.:L007353）, is a chemical compound with a phenylphenoxypropanoic acid structure. This molecule is widely used in research and industry for various purposes. Its versatile chemical properties make it valuable for synthesis and chemical reactions. Researchers often employ it as a building block in organic synthesis, allowing for the creation of more complex compounds. Its applications range from pharmaceutical research to materials science, demonstrating its importance in the development of new drugs, polymers, and other innovative materials. Its specific chemical structure allows scientists to explore diverse chemical pathways, leading to advancements in various scientific fields.