Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3-(5-Amino-1-oxoisoindolin-2-yl)piperidine-2,6-dione
For research use only. Not for therapeutic Use.
3-(5-Amino-1-oxoisoindolin-2-yl)piperidine-2,6-dione(CAT: L000326) is a compound of great importance in pharmaceutical and organic chemistry. This chemical serves as a crucial intermediate in the synthesis of pharmaceutical compounds, particularly in the development of drugs targeting specific biological pathways. Its primary application lies in the creation of therapeutic agents for various medical conditions, including neurological and psychiatric disorders.
CAS Number | 191732-70-4 |
Molecular Formula | C13H13N3O3 |
Purity | ≥95% |
IUPAC Name | 3-(6-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
InChI | InChI=1S/C13H13N3O3/c14-8-1-2-9-7(5-8)6-16(13(9)19)10-3-4-11(17)15-12(10)18/h1-2,5,10H,3-4,6,14H2,(H,15,17,18) |
InChIKey | WLUIQUZGNPAKRL-UHFFFAOYSA-N |