Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3-(5-(Aminomethyl)-1-oxoisoindolin-2-yl)piperidine-2,6-dione hydrochloride
For research use only. Not for therapeutic Use.
3-(5-(Aminomethyl)-1-oxoisoindolin-2-yl)piperidine-2,6-dione hydrochloride(CAT: L000281) is a compound with notable significance in pharmaceutical chemistry. This molecule plays a key role in the development of pharmaceuticals and therapeutic agents. Its action method involves serving as a vital component in the synthesis of drug candidates, particularly in the context of drug discovery and development.
Catalog Number | L000281 |
CAS Number | 1158264-69-7 |
Molecular Formula | C14H16ClN3O3 |
Purity | ≥95% |
Target | Ligands for E3 Ligase |
IUPAC Name | 3-[6-(aminomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride |
InChI | InChI=1S/C14H15N3O3.ClH/c15-6-8-1-2-10-9(5-8)7-17(14(10)20)11-3-4-12(18)16-13(11)19;/h1-2,5,11H,3-4,6-7,15H2,(H,16,18,19);1H |
InChIKey | XTILEMYXOZKSFJ-UHFFFAOYSA-N |