For research use only. Not for therapeutic Use.
3-(5-Bromo-2-fluoro-phenyl)propan-1-ol(Cat No.:L007581), is a chemical compound featuring a propanol backbone with a bromo-fluoro substituted phenyl group at the 3-position. This specific molecular arrangement is of interest in medicinal chemistry and organic synthesis. Researchers explore its reactivity and potential biological activities, aiming to develop new compounds for pharmaceutical applications. Its unique structure allows for diverse chemical modifications, making it valuable as a building block for the creation of novel molecules.
CAS Number | 1057673-68-3 |
Molecular Formula | C9H10BrFO |
Purity | ≥95% |
IUPAC Name | 3-(5-bromo-2-fluorophenyl)propan-1-ol |
InChI | InChI=1S/C9H10BrFO/c10-8-3-4-9(11)7(6-8)2-1-5-12/h3-4,6,12H,1-2,5H2 |
InChIKey | RADLVHVOWIOWAY-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Br)CCCO)F |