Home
>
Chemical Reagents>Organic Building Blocks> 3-[[5-Methyl-2-(1-methylethyl)cyclohexyl]oxy]propane-1,2-diol
For research use only. Not for therapeutic Use.
3-[[5-Methyl-2-(1-methylethyl)cyclohexyl]oxy]propane-1,2-diol(Cat No.:L015200)is a specialized organic compound with a unique cyclohexyl ether structure, widely used in pharmaceutical and chemical research. This molecule features a 5-methyl-2-isopropylcyclohexyl group linked to a propane-1,2-diol backbone, enhancing its versatility as a synthetic intermediate. It plays a crucial role in developing advanced compounds, particularly in drug synthesis and formulation. With its distinct molecular architecture, 3-[[5-Methyl-2-(1-methylethyl)cyclohexyl]oxy]propane-1,2-diol is essential for researchers focused on creating novel therapeutic agents.
Catalog Number | L015200 |
CAS Number | 87061-04-9 |
Molecular Formula | C13H26O3 |
Purity | ≥95% |
IUPAC Name | 3-(5-methyl-2-propan-2-ylcyclohexyl)oxypropane-1,2-diol |
InChI | InChI=1S/C13H26O3/c1-9(2)12-5-4-10(3)6-13(12)16-8-11(15)7-14/h9-15H,4-8H2,1-3H3 |
InChIKey | MDVYIGJINBYKOM-UHFFFAOYSA-N |
SMILES | CC1CCC(C(C1)OCC(CO)O)C(C)C |