Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 3-(6-Chloro-2-methoxypyridin-3-yl)-3-methylpiperidin-2-one
For research use only. Not for therapeutic Use.
3-(6-Chloro-2-methoxypyridin-3-yl)-3-methylpiperidin-2-one(CAT: L008999) is a chemically intricate compound with potential applications in various fields. Its unique structure combines a piperidone ring with a chlorinated pyridine moiety, suggesting multifaceted interactions. This compound may participate in specific biological processes, making it interesting for medicinal chemistry and drug discovery. Its mode of action could involve modulating cellular pathways, potentially affecting disease-related mechanisms. Its distinct chemical attributes allow for the creation of complex molecular architectures, contributing to the design of innovative compounds in pharmaceuticals and materials science.
Catalog Number | L008999 |
CAS Number | 1693763-28-8 |
Molecular Formula | C12H15ClN2O2 |
Purity | ≥95% |
IUPAC Name | 3-(6-chloro-2-methoxypyridin-3-yl)-3-methylpiperidin-2-one |
InChI | InChI=1S/C12H15ClN2O2/c1-12(6-3-7-14-11(12)16)8-4-5-9(13)15-10(8)17-2/h4-5H,3,6-7H2,1-2H3,(H,14,16) |
InChIKey | WAIMOOPDMOJEIR-UHFFFAOYSA-N |