For research use only. Not for therapeutic Use.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxyphenyl)propanoic acid(Cat No.:L006836), is a complex organic compound widely used in the field of medicinal chemistry and drug development. Its molecular structure contains a fluorenyl methoxycarbonyl (Fmoc) protected amino group, a 4-methoxyphenyl group, and a propanoic acid moiety. Researchers use this compound as a key intermediate in the synthesis of peptide-based pharmaceuticals and bioactive molecules.
Catalog Number | L006836 |
CAS Number | 284492-02-0 |
Molecular Formula | C25H23NO5 |
Purity | ≥95% |
IUPAC Name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxyphenyl)propanoic acid |
InChI | InChI=1S/C25H23NO5/c1-30-17-12-10-16(11-13-17)23(14-24(27)28)26-25(29)31-15-22-20-8-4-2-6-18(20)19-7-3-5-9-21(19)22/h2-13,22-23H,14-15H2,1H3,(H,26,29)(H,27,28) |
InChIKey | GXOCWIPOYXOZAF-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C(CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |