Home
>
Chemical Reagents>Organic Building Blocks> 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)(propyl)amino)propanoic acid
For research use only. Not for therapeutic Use.
3-((((9H-Fluoren-9-yl)methoxy)carbonyl)(propyl)amino)propanoic acid(CAT: L000130) is a crucial compound in the realm of organic chemistry and pharmaceutical research. This chemical demonstrates a multifaceted action method by targeting specific enzymes or receptors, making it a promising candidate for drug development. In the pharmaceutical sector, it is extensively utilized for the synthesis of prodrugs and drug conjugates, especially in the design of innovative therapies for various medical conditions.
CAS Number | 2171909-89-8 |
Molecular Formula | C21H23NO4 |
Purity | ≥95% |
IUPAC Name | 3-[9H-fluoren-9-ylmethoxycarbonyl(propyl)amino]propanoic acid |
InChI | InChI=1S/C21H23NO4/c1-2-12-22(13-11-20(23)24)21(25)26-14-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h3-10,19H,2,11-14H2,1H3,(H,23,24) |
InChIKey | FDDVCHDTTFLIAA-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |