For research use only. Not for therapeutic Use.
3-Acetyl-6-(trifluoromethyl)-1,2-dihydropyridin-2-one (Cat.No:L003598) is a significant chemical compound in medicinal chemistry. Its unique structure, incorporating a trifluoromethyl group, imparts distinctive pharmacological properties. This compound is employed as a key intermediate in the synthesis of pharmaceutical agents, particularly in the development of potential drug candidates due to its bioactive scaffold.
CAS Number | 116548-05-1 |
Molecular Formula | C8H6F3NO2 |
Purity | ≥95% |
IUPAC Name | 3-acetyl-6-(trifluoromethyl)-1H-pyridin-2-one |
InChI | InChI=1S/C8H6F3NO2/c1-4(13)5-2-3-6(8(9,10)11)12-7(5)14/h2-3H,1H3,(H,12,14) |
InChIKey | OCXZQCGYAFJZQA-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC=C(NC1=O)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |