For research use only. Not for therapeutic Use.
3-Acetylthio-2-methylpropionic acid(CAT: R003075) is a chemical compound used as an intermediate in organic synthesis. It contains an acetyl group and a thioether group, making it suitable for various reactions in the field of organic chemistry. This compound can be utilized in the preparation of diverse molecules for pharmaceuticals, agrochemicals, and other fine chemicals. Its versatile structure makes it valuable for creating complex molecules with specific properties and functions.
CAS Number | 33325-40-5 |
Synonyms | 3-(Acetylthio)-2-methylpropanoic Acid; 3-Mercapto-2-methylpropionic Acid Acetate (RS)-3-Acetylthio-2-methylpropionic Acid; (±)-3-Acetylthio-2-methylpropionic Acid; 2-(Acetylthiomethyl)propanoic Acid; 3-(Acetylthio)-2-methylpropanoic Acid; 3-Acetylsul |
Molecular Formula | C6H10O3S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-acetylsulfanyl-2-methylpropanoic acid |
InChI | InChI=1S/C6H10O3S/c1-4(6(8)9)3-10-5(2)7/h4H,3H2,1-2H3,(H,8,9) |
InChIKey | VFVHNRJEYQGRGE-UHFFFAOYSA-N |
SMILES | CC(CSC(=O)C)C(=O)O |