For research use only. Not for therapeutic Use.
3′-Adenylic acid (Cat.No: I014004), also known as adenosine-3′-monophosphate (AMP), is a nucleotide that plays a vital role in cellular metabolism as a precursor to adenosine triphosphate (ATP), the primary energy source for cells. It is also a key component in RNA, serving as one of the four building blocks that make up the nucleic acid. AMP has been studied for its potential therapeutic benefits, including its role in regulating inflammation and immune responses.
| Catalog Number | I014004 |
| CAS Number | 84-21-9 |
| Synonyms | 3′-Adenylic acid;;Adenosine 3′-phosphate monohydrate |
| Molecular Formula | C10H14N5O7P |
| Purity | ≥95% |
| Target | Nucleoside Antimetabolite/Analog |
| Solubility | Soluble in DMSO |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
| InChI | InChI=1S/C10H14N5O7P.H2O/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(17)7(4(1-16)21-10)22-23(18,19)20;/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20);1H2/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | HAWIDQLWSQBRQS-MCDZGGTQSA-N |
| SMILES | OC[C@@H]1[C@@H](OP(O)(O)=O)[C@H]([C@H](N2C=NC3=C(N=CN=C32)N)O1)O.[H]O[H] |
| Reference | </br> 1: Yanagawa H, Ogawa Y, Miyakawa A, Egami F. DNase A, a poly(dA) and poly(dT)-specific deoxyribonuclease from Achatina fulica. Purification and characterization. J Biochem. 1981 Nov;90(5):1463-78. PubMed PMID: 7338515.</br>2: Iizuka H, Adachi K, Halprin KM, Levine V. Adenosine and adenine nucleotides stimulation of skin (epidermal) adenylate cyclase. Biochim Biophys Acta. 1976 Oct 22;444(3):685-93. PubMed PMID: 186102.</br></br> |
