For research use only. Not for therapeutic Use.
3-Amino-1-phenylpiperidin-2-one(Cat No.:L007366), is a chemical compound with significance in medicinal chemistry and drug discovery. Its molecular structure includes a piperidine core with an amino group at the third carbon atom and a phenyl group attached to the nitrogen atom. This compound is utilized in pharmaceutical research as a scaffold for the design and synthesis of novel compounds, particularly in the development of potential therapeutic agents.
CAS Number | 1233344-51-8 |
Molecular Formula | C11H14N2O |
Purity | ≥95% |
IUPAC Name | 3-amino-1-phenylpiperidin-2-one |
InChI | InChI=1S/C11H14N2O/c12-10-7-4-8-13(11(10)14)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8,12H2 |
InChIKey | XYZGJLDFMCEELX-UHFFFAOYSA-N |
SMILES | C1CC(C(=O)N(C1)C2=CC=CC=C2)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |