For research use only. Not for therapeutic Use.
3-Amino-1H-pyrazol-5-ol(Cat No.:L048935)is a versatile heterocyclic compound used in pharmaceutical and chemical research. Featuring both an amino group and a hydroxyl group on the pyrazole ring, this compound serves as a crucial building block in the synthesis of bioactive molecules. It is particularly valuable in the development of new drug candidates, including enzyme inhibitors and anti-inflammatory agents. Its ability to participate in various chemical reactions makes it an essential intermediate for advanced organic synthesis and medicinal chemistry applications, offering high purity and consistent quality.
CAS Number | 145092-03-1 |
Molecular Formula | C3H5N3O |
Purity | ≥95% |
IUPAC Name | 5-amino-1,2-dihydropyrazol-3-one |
InChI | InChI=1S/C3H5N3O/c4-2-1-3(7)6-5-2/h1H,(H4,4,5,6,7) |
InChIKey | QZBGOTVBHYKUDS-UHFFFAOYSA-N |
SMILES | C1=C(NNC1=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |