For research use only. Not for therapeutic Use.
3-Amino-1H-pyrazol-5-ol（Cat No.:L048935）is a versatile heterocyclic compound used in pharmaceutical and chemical research. Featuring both an amino group and a hydroxyl group on the pyrazole ring, this compound serves as a crucial building block in the synthesis of bioactive molecules. It is particularly valuable in the development of new drug candidates, including enzyme inhibitors and anti-inflammatory agents. Its ability to participate in various chemical reactions makes it an essential intermediate for advanced organic synthesis and medicinal chemistry applications, offering high purity and consistent quality.
| Catalog Number | L048935 |
| CAS Number | 145092-03-1 |
| Molecular Formula | C3H5N3O |
| Purity | ≥95% |
| IUPAC Name | 5-amino-1,2-dihydropyrazol-3-one |
| InChI | InChI=1S/C3H5N3O/c4-2-1-3(7)6-5-2/h1H,(H4,4,5,6,7) |
| InChIKey | QZBGOTVBHYKUDS-UHFFFAOYSA-N |
| SMILES | C1=C(NNC1=O)N |
