For research use only. Not for therapeutic Use.
3-Amino-2-fluorobenzonitrile is an organic compound with a benzene ring, featuring an amino group (-NH₂) at the 3-position, a fluorine atom at the 2-position, and a nitrile group (-CN) at the 1-position. The amino and nitrile groups introduce nucleophilic and electron-withdrawing properties, respectively, while the fluorine enhances the compound’s reactivity. This structure makes it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals, agrochemicals, and other bioactive compounds with potential anticancer or antimicrobial properties.
CAS Number | 873697-68-8 |
Molecular Formula | C7H5FN2 |
Purity | ≥95% |
IUPAC Name | 3-amino-2-fluorobenzonitrile |
InChI | InChI=1S/C7H5FN2/c8-7-5(4-9)2-1-3-6(7)10/h1-3H,10H2 |
InChIKey | BFGCKEHSFRPNRZ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)N)F)C#N |