For research use only. Not for therapeutic Use.
3-Amino-2-methoxycarbonylthiophene(CAT: R044891) is an organic compound with a thiophene ring substituted with an amino group at position 3 and a methoxycarbonyl group at position 2. Its mode of action involves serving as a building block in organic synthesis and as a starting material for the preparation of various heterocyclic compounds. Pharmacologically, 3-Amino-2-methoxycarbonylthiophene is not used as a therapeutic drug. Instead, it is primarily used in chemical research and in the pharmaceutical industry to synthesize complex molecules and develop potential drug candidates. Its versatile structure and reactivity make it a valuable intermediate in the preparation of various biologically active compounds.
CAS Number | 22288-78-4 |
Synonyms | 3-Amino-2-thiophenecarboxylic acid Methyl Ester;?3-Aminothiophen-2-carboxylic acid Methyl Ester; Methyl 3-Amino-2-thiophenecarboxylate; Methyl 3-Aminothiophene-2-carboxylate |
Molecular Formula | C6H7NO2S |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | methyl 3-aminothiophene-2-carboxylate |
InChI | InChI=1S/C6H7NO2S/c1-9-6(8)5-4(7)2-3-10-5/h2-3H,7H2,1H3 |
InChIKey | TWEQNZZOOFKOER-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=CS1)N |