For research use only. Not for therapeutic Use.
3-Amino-2-methyl-benzyl Alcohol is an organic compound featuring an amino group and a hydroxyl group on a benzene ring, with a methyl substituent at the 2-position. This structure imparts unique chemical properties, making it a valuable intermediate in organic synthesis. It is utilized in the production of pharmaceuticals, agrochemicals, and specialty chemicals. The compound’s ability to participate in various reactions, such as nucleophilic substitutions and reductions, enhances its application in developing biologically active molecules and innovative chemical formulations.
CAS Number | 83647-42-1 |
Synonyms | (3-Amino-2-methylphenyl)methanol; 2-Methyl-3-hydroxymethylaniline |
Molecular Formula | C8H11NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (3-amino-2-methylphenyl)methanol |
InChI | InChI=1S/C8H11NO/c1-6-7(5-10)3-2-4-8(6)9/h2-4,10H,5,9H2,1H3 |
InChIKey | UVYZMJMDIMWDNJ-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC=C1N)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |