Home
>
Chemical Reagents>Organic Building Blocks> 3-Amino-3-(4-fluoronaphthalen-1-yl)propanoic acid hydrochloride
For research use only. Not for therapeutic Use.
3-Amino-3-(4-fluoronaphthalen-1-yl)propanoic acid hydrochloride(Cat No.:L027942)is an amino acid derivative featuring a fluoronaphthyl group at the β-position and an amino group at the α-position, with the compound in its hydrochloride salt form. This structure is significant in pharmaceutical research, particularly in the development of peptide mimetics and bioactive molecules. The hydrochloride form enhances its solubility and stability, making it suitable for various synthetic and analytical applications. 3-Amino-3-(4-fluoronaphthalen-1-yl)propanoic acid hydrochloride is essential for advancing research in medicinal chemistry and drug design.
CAS Number | 1810070-00-8 |
Molecular Formula | C13H13ClFNO2 |
Purity | ≥95% |
IUPAC Name | 3-amino-3-(4-fluoronaphthalen-1-yl)propanoic acid;hydrochloride |
InChI | InChI=1S/C13H12FNO2.ClH/c14-11-6-5-10(12(15)7-13(16)17)8-3-1-2-4-9(8)11;/h1-6,12H,7,15H2,(H,16,17);1H |
InChIKey | UEXQFINGQDQACH-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=CC=C2F)C(CC(=O)O)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |