For research use only. Not for therapeutic Use.
3-Amino-3-(4-methoxyphenyl) cyclobutane-1-ol (Cat No.:L007499), is a chemical compound of interest in organic chemistry. Its molecular structure comprises a cyclobutanone ring substituted with an amino group and a 4-methoxyphenyl (p-anisyl) group. This compound is notable for its potential applications in medicinal chemistry and drug discovery. Researchers study its unique structure and reactivity to explore its pharmacological properties and potential therapeutic uses. Investigations into its interactions with biological targets are essential for developing new medications.
Catalog Number | L007499 |
CAS Number | 1353636-82-4 |
Molecular Formula | C11H15NO2 |
Purity | ≥95% |
IUPAC Name | 3-amino-3-(4-methoxyphenyl)cyclobutan-1-ol |
InChI | InChI=1S/C11H15NO2/c1-14-10-4-2-8(3-5-10)11(12)6-9(13)7-11/h2-5,9,13H,6-7,12H2,1H3 |
InChIKey | TYBCCVMYRJUCOA-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C2(CC(C2)O)N |