Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3-Amino-3-(furan-2-yl)propanoic acid hydrochloride
For research use only. Not for therapeutic Use.
3-Amino-3-(furan-2-yl)propanoic acid hydrochloride (Cat.No:L003909) is a vital compound in pharmaceutical research. Its distinctive structure, featuring both an amino and furan group, offers unique reactivity and potential therapeutic applications. This compound serves as a crucial intermediate in the synthesis of specialized molecules with pharmaceutical relevance.
CAS Number | 2177263-70-4 |
Molecular Formula | C7H10ClNO3 |
Purity | ≥95% |
IUPAC Name | 3-amino-3-(furan-2-yl)propanoic acid;hydrochloride |
InChI | InChI=1S/C7H9NO3.ClH/c8-5(4-7(9)10)6-2-1-3-11-6;/h1-3,5H,4,8H2,(H,9,10);1H |
InChIKey | OWQPNOKUHDOIBK-UHFFFAOYSA-N |
SMILES | C1=COC(=C1)C(CC(=O)O)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |