For research use only. Not for therapeutic Use.
3-Amino-4-bromobenzenesulfonamide(Cat No.:L007808), is a chemical compound represented by the molecular formula C6H6BrNO2S. This compound consists of a benzene ring substituted with an amino group (-NH2) at the 3rd carbon position and a bromine atom at the 4th carbon position. Additionally, a sulfonamide group (-SO2NH2) is attached to the benzene ring, providing distinctive chemical properties. Compounds like 3-Amino-4-bromobenzenesulfonamide are often utilized in organic synthesis and medicinal chemistry, where specific functional groups are crucial for designing molecules with desired biological activities or reactivity patterns.
CAS Number | 100367-90-6 |
Molecular Formula | C6H7BrN2O2S |
Purity | ≥95% |
IUPAC Name | 3-amino-4-bromobenzenesulfonamide |
InChI | InChI=1S/C6H7BrN2O2S/c7-5-2-1-4(3-6(5)8)12(9,10)11/h1-3H,8H2,(H2,9,10,11) |
InChIKey | AUFMHQSAEAOXHZ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1S(=O)(=O)N)N)Br |