For research use only. Not for therapeutic Use.
3-Amino-4-bromothiophene-2-carboxamide (Cat.No:L004037) is a pivotal chemical compound in pharmaceutical research. Its unique structure, combining an amino group, bromine, and thiophene, imparts distinctive reactivity. This compound serves as a valuable scaffold in the synthesis of bioactive molecules, particularly in drug discovery.
CAS Number | 1378876-49-3 |
Molecular Formula | C5H5BrN2OS |
Purity | ≥95% |
IUPAC Name | 3-amino-4-bromothiophene-2-carboxamide |
InChI | InChI=1S/C5H5BrN2OS/c6-2-1-10-4(3(2)7)5(8)9/h1H,7H2,(H2,8,9) |
InChIKey | NBSUCRGJFNARQP-UHFFFAOYSA-N |
SMILES | C1=C(C(=C(S1)C(=O)N)N)Br |