For research use only. Not for therapeutic Use.
3-Amino-4-ethylbenzoic Acid(CAT: L040668) is an organic compound consisting of a benzoic acid core with an amino group (-NH₂) at the 3-position and an ethyl group (-CH₂CH₃) at the 4-position. The presence of the amino group makes this compound a useful building block in the synthesis of various pharmaceuticals, agrochemicals, and dyes, as it can participate in coupling and amidation reactions. The ethyl group adds a small degree of lipophilicity to the molecule, potentially influencing its solubility and reactivity. This compound is commonly used as an intermediate in organic synthesis for the preparation of more complex molecules.
CAS Number | 5129-23-7 |
Molecular Formula | C9H11NO2 |
Purity | ≥95% |
IUPAC Name | 3-amino-4-ethylbenzoic acid |
InChI | InChI=1S/C9H11NO2/c1-2-6-3-4-7(9(11)12)5-8(6)10/h3-5H,2,10H2,1H3,(H,11,12) |
InChIKey | LLZSVDFDTYGEEG-UHFFFAOYSA-N |