For research use only. Not for therapeutic Use.
3-Amino-4-fluorophenol is an aromatic compound featuring both an amino group at the 3-position and a fluorine atom at the 4-position on a phenol ring. This compound is valuable in organic synthesis, particularly for developing pharmaceuticals, agrochemicals, and dyes. Its combination of hydroxyl, amino, and fluorine functional groups allows for diverse reactivity and further functionalization, making it a useful intermediate in medicinal chemistry. It is often explored for its potential biological activity and utility in producing complex molecular structures.
CAS Number | 62257-16-3 |
Molecular Formula | C6H6FNO |
Purity | ≥95% |
IUPAC Name | 3-amino-4-fluorophenol |
InChI | InChI=1S/C6H6FNO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H,8H2 |
InChIKey | VJCSFNNTQGRAKH-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1O)N)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |