For research use only. Not for therapeutic Use.
3-Amino-4-iodo-1h-pyrazole (Cat.No: R039064) is an organic building block that can be used as a pharmaceutical organic intermediate for drug preparation and research and development in the pharmaceutical chemical industry, mainly for scientific research.
| Catalog Number | R039064 |
| CAS Number | 81542-51-0 |
| Molecular Formula | C3H4IN3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-iodo-1H-pyrazol-5-amine |
| InChI | InChI=1S/C3H4IN3/c4-2-1-6-7-3(2)5/h1H,(H3,5,6,7) |
| InChIKey | CPVCVVMJPIOKMN-UHFFFAOYSA-N |
| SMILES | C1=NNC(=C1I)N |
