For research use only. Not for therapeutic Use.
3-Amino-5-bromobenzene-1-sulfonamide(Cat No.:L007832), is a chemical compound with applications in the field of organic synthesis. This molecule contains an amino group, a bromine atom, and a sulfonamide functional group on a benzene ring. Compounds like this are valuable intermediates in pharmaceutical research, allowing for the development of potential drugs and bioactive molecules. Scientists use these intermediates to explore new chemical pathways and create diverse libraries of compounds for drug discovery. The unique combination of functional groups in this compound makes it a valuable building block for designing novel therapeutic agents.
CAS Number | 1261817-84-8 |
Molecular Formula | C6H7BrN2O2S |
Purity | ≥95% |
IUPAC Name | 3-amino-5-bromobenzenesulfonamide |
InChI | InChI=1S/C6H7BrN2O2S/c7-4-1-5(8)3-6(2-4)12(9,10)11/h1-3H,8H2,(H2,9,10,11) |
InChIKey | OMHCJSZERNZPJB-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1S(=O)(=O)N)Br)N |