For research use only. Not for therapeutic Use.
3-Amino-5-fluorophenol(Cat No.:L006777). It consists of a phenolic ring with an amino group at the 3-position and a fluorine atom at the 5-position. This compound is used as a key intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its specific structure enables diverse chemical transformations, making it valuable in the creation of complex molecules. Researchers utilize it in medicinal chemistry, enabling the development of novel drugs. Its applications contribute to advancements in the fields of pharmaceuticals and organic synthesis, facilitating the creation of diverse biologically active compounds.
CAS Number | 1167055-92-6 |
Molecular Formula | C6H6FNO |
Purity | ≥95% |
IUPAC Name | 3-amino-5-fluorophenol |
InChI | InChI=1S/C6H6FNO/c7-4-1-5(8)3-6(9)2-4/h1-3,9H,8H2 |
InChIKey | NMAMRLDELSMXON-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1O)F)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |