For research use only. Not for therapeutic Use.
3-Amino-6-methoxy-5-methylpyridine is a pyridine derivative featuring an amino group, a methoxy group, and a methyl substituent. This compound has potential applications in medicinal chemistry due to its ability to interact with biological targets, making it a candidate for drug development. Its structural features may contribute to activities such as anti-inflammatory and antimicrobial effects. Research focuses on its synthesis, optimization, and the exploration of its pharmacological properties, paving the way for novel therapeutic agents based on its scaffold.
CAS Number | 867012-70-2 |
Molecular Formula | C7H10N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-methoxy-5-methylpyridin-3-amine |
InChI | InChI=1S/C7H10N2O/c1-5-3-6(8)4-9-7(5)10-2/h3-4H,8H2,1-2H3 |
InChIKey | RFEMLHVKBYMWAM-UHFFFAOYSA-N |
SMILES | CC1=CC(=CN=C1OC)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |