For research use only. Not for therapeutic Use.
3-Amino-7-azaindole(Cat No.:R038219)is a heterocyclic compound featuring an indole core with an amino group at the 3-position and a nitrogen atom at the 7-position. This compound is significant in medicinal chemistry due to its potential as a pharmacophore in drug design. It exhibits diverse biological activities, making it a valuable scaffold for developing therapeutic agents targeting various diseases, including cancer, infections, and neurological disorders. Its unique structure allows for versatile chemical modifications, enhancing its utility in synthesizing novel compounds for advanced pharmaceutical research and development.
CAS Number | 189882-31-3 |
Molecular Formula | C7H7N3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 1H-pyrrolo[2,3-b]pyridin-3-amine |
InChI | InChI=1S/C7H7N3/c8-6-4-10-7-5(6)2-1-3-9-7/h1-4H,8H2,(H,9,10) |
InChIKey | HCTKTFWOSSBSIL-UHFFFAOYSA-N |
SMILES | C1=CC2=C(NC=C2N)N=C1 |