For research use only. Not for therapeutic Use.
3-Amino-N-ethylisonicotinamide(CAT: L018956) is a key chemical compound employed in advanced pharmaceutical and biochemical research. This compound features an amino group attached to the isonicotinamide core, which enhances its reactivity and interaction with biological molecules. It plays a crucial role in medicinal chemistry, particularly in the synthesis of drug candidates targeting various enzymes or receptors. The N-ethyl side chain increases its solubility and pharmacokinetic properties, making it suitable for drug development and biochemical assays. With its versatile structure, 3-Amino-N-ethylisonicotinamide is ideal for researchers exploring new therapeutic pathways and novel drug formulations.
CAS Number | 1415147-02-2 |
Molecular Formula | C8H11N3O |
Purity | ≥95% |
IUPAC Name | 3-amino-N-ethylpyridine-4-carboxamide |
InChI | InChI=1S/C8H11N3O/c1-2-11-8(12)6-3-4-10-5-7(6)9/h3-5H,2,9H2,1H3,(H,11,12) |
InChIKey | FRTCMFGQFXNBML-UHFFFAOYSA-N |