For research use only. Not for therapeutic Use.
3-Aminobiphenyl-d9 is a deuterated version of 3-Aminobiphenyl, featuring nine deuterium atoms. This compound is essential for research in environmental chemistry and toxicology, particularly in studies involving the tracking of aromatic amine metabolism and carcinogenicity. The stable isotope labeling allows for precise detection in mass spectrometry, providing enhanced accuracy in identifying metabolic pathways and analyzing toxicological effects. 3-Aminobiphenyl-d9 is a valuable tool for scientists investigating the environmental impact, biological activity, and safety of aromatic amines, offering reliable data for high-precision studies in chemical and environmental research.
CAS Number | 1020718-93-7 |
Synonyms | m-Phenylaniline-d9; 3-Aminobiphenyl-d9; 3-Amino-1,1’-biphenyl-d9; [1,1’-Biphenyl]-3-amine; 3-Biphenylamine-d9; |
Molecular Formula | C12H11N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)aniline |
InChI | InChI=1S/C12H11N/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H,13H2/i1D,2D,3D,4D,5D,6D,7D,8D,9D |
InChIKey | MUNOBADFTHUUFG-LOIXRAQWSA-N |
SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)N |