For research use only. Not for therapeutic Use.
3-Aminoisoquinoline-7-carboxylic acid(Cat No.:L025640)is a key organic compound utilized in the synthesis of pharmaceuticals, especially in creating kinase inhibitors and anticancer agents. It contains an isoquinoline scaffold substituted with an amino group at the 3-position and a carboxylic acid group at the 7-position. This structure is crucial for binding interactions with biological targets, enhancing drug design flexibility. Its presence in precursor molecules allows for the exploration of new drug candidates with potential therapeutic applications in treating diseases where regulation of kinase activity is critical.
CAS Number | 1337881-34-1 |
Molecular Formula | C10H8N2O2 |
Purity | ≥95% |
IUPAC Name | 3-aminoisoquinoline-7-carboxylic acid |
InChI | InChI=1S/C10H8N2O2/c11-9-4-6-1-2-7(10(13)14)3-8(6)5-12-9/h1-5H,(H2,11,12)(H,13,14) |
InChIKey | JWYMSZPSIYOAJA-UHFFFAOYSA-N |
SMILES | C1=CC(=CC2=CN=C(C=C21)N)C(=O)O |