For research use only. Not for therapeutic Use.
3-(Aminomethyl)-2-fluorophenol hydrobromide(Cat No.:L007772), is a chemical compound with the molecular formula C₇H₈FNO·HBr. In this structure, an amino group (-NH₂) is attached to the second carbon of a phenol ring, and a fluorine atom is positioned at the third carbon. Additionally, it contains a hydrobromide salt (HBr) to enhance its stability and solubility in water. This compound is of interest in the field of organic synthesis and medicinal chemistry. Researchers might explore its reactivity, study its pharmacological properties, or employ it as a starting material in the synthesis of various biologically active compounds, including potential pharmaceutical agents.
CAS Number | 1143571-75-8 |
Molecular Formula | C7H9BrFNO |
Purity | ≥95% |
IUPAC Name | 3-(aminomethyl)-2-fluorophenol;hydrobromide |
InChI | InChI=1S/C7H8FNO.BrH/c8-7-5(4-9)2-1-3-6(7)10;/h1-3,10H,4,9H2;1H |
InChIKey | RGXUBEPXBQKRHJ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)O)F)CN.Br |