For research use only. Not for therapeutic Use.
3-(Aminomethyl)-5-chloroaniline(Cat No.:L007540), is a chemical compound characterized by an aniline ring substituted with an aminomethyl group at the 3rd position and a chlorine atom at the 5th position. This compound is significant in medicinal chemistry and drug discovery research. Its unique structure suggests potential pharmacological activities, making it valuable for further exploration in the development of pharmaceutical agents. Researchers study its reactivity and interactions with biological targets, aiming to design novel drugs. Investigations involving this compound contribute to advancements in medicinal chemistry, fostering the development of innovative therapies for various medical applications, including oncology and neuroscience.
CAS Number | 683740-35-4 |
Molecular Formula | C7H9ClN2 |
Purity | ≥95% |
IUPAC Name | 3-(aminomethyl)-5-chloroaniline |
InChI | InChI=1S/C7H9ClN2/c8-6-1-5(4-9)2-7(10)3-6/h1-3H,4,9-10H2 |
InChIKey | WIVZFVALCYRYIQ-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1N)Cl)CN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |