For research use only. Not for therapeutic Use.
3-(Aminomethyl)-5-fluorophenol hydrochloride (Cat.No:L003460) is a crucial chemical compound in pharmaceutical research. Its distinct structure and reactivity make it a valuable building block for the synthesis of potential drug candidates. This compound holds promise for applications in medicinal chemistry, particularly in the development of novel therapeutics.
CAS Number | 2061979-49-3 |
Molecular Formula | C7H9ClFNO |
Purity | ≥95% |
IUPAC Name | 3-(aminomethyl)-5-fluorophenol;hydrochloride |
InChI | InChI=1S/C7H8FNO.ClH/c8-6-1-5(4-9)2-7(10)3-6;/h1-3,10H,4,9H2;1H |
InChIKey | UIOOXMXKTMCDJF-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1O)F)CN.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |