For research use only. Not for therapeutic Use.
3-Aminophthalimide is a heterocyclic compound widely used in organic synthesis and pharmaceutical research. With an amine group at the 3-position of the phthalimide ring, it serves as a versatile intermediate for synthesizing dyes, polymers, and bioactive molecules. This compound is particularly valuable in the development of fluorescent probes and sensors due to its photophysical properties. Additionally, 3-Aminophthalimide’s reactivity allows for various chemical modifications, contributing to advancements in medicinal chemistry and the design of novel therapeutic agents.
CAS Number | 2518-24-3 |
Molecular Formula | C8H6N2O2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 4-aminoisoindole-1,3-dione |
InChI | InChI=1S/C8H6N2O2/c9-5-3-1-2-4-6(5)8(12)10-7(4)11/h1-3H,9H2,(H,10,11,12) |
InChIKey | GQBONCZDJQXPLV-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=C1)N)C(=O)NC2=O |