For research use only. Not for therapeutic Use.
3-Aminopicolinic acid is a pyridine derivative featuring an amino group at the 3rd position and a carboxylic acid group on the ring. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other bioactive molecules. Its unique structure makes it valuable for developing inhibitors and ligands in medicinal chemistry. Additionally, 3-aminopicolinic acid is studied for its potential applications in metal chelation and coordination chemistry, contributing to research in materials science and catalysis.
| Catalog Number | R000017 |
| CAS Number | 1462-86-8 |
| Synonyms | 3-Aminopyridine-2-carboxylic Acid; 3-Amino-2-pyridinecarboxylic Acid; |
| Molecular Formula | C6H6N2O2 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | 3-aminopyridine-2-carboxylic acid |
| InChI | InChI=1S/C6H6N2O2/c7-4-2-1-3-8-5(4)6(9)10/h1-3H,7H2,(H,9,10) |
| InChIKey | BOOMHTFCWOJWFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(=O)O)N |
