For research use only. Not for therapeutic Use.
(3-Aminopropyl)glycine(Cat No.:I043003)is a modified amino acid that contains an additional amino group on the side chain of glycine, making it a derivative of the naturally occurring amino acid glycine. This compound is used primarily in biochemical and pharmacological research, particularly in studies of neurotransmission and metabolic pathways. It has potential applications in neuroscience due to its ability to interact with neurotransmitter systems, especially in the regulation of gamma-aminobutyric acid (GABA) receptors. Additionally, (3-Aminopropyl)glycine could be explored for its role in drug development and as a building block in the synthesis of bioactive molecules.
CAS Number | 2875-41-4 |
Synonyms | 2-(3-aminopropylamino)acetic acid |
Molecular Formula | C5H12N2O2 |
Purity | ≥95% |
IUPAC Name | 2-(3-aminopropylamino)acetic acid |
InChI | InChI=1S/C5H12N2O2/c6-2-1-3-7-4-5(8)9/h7H,1-4,6H2,(H,8,9) |
InChIKey | DHGYLUFLENKZHH-UHFFFAOYSA-N |
SMILES | C(CN)CNCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |