For research use only. Not for therapeutic Use.
3-Azabicyclo[3.2.1]octane hydrochloride(CAT: L013401) is a high-purity bicyclic amine compound widely used in pharmaceutical and chemical research. Its unique structure, featuring a nitrogen-containing azabicyclo framework, makes it a versatile intermediate in the synthesis of biologically active molecules, including drug candidates and natural product derivatives. The hydrochloride salt form enhances its stability and solubility, ensuring consistent performance in experimental applications. 3-Azabicyclo[3.2.1]octane hydrochloride is particularly valuable in medicinal chemistry and materials science, facilitating the development of innovative therapeutic agents and specialized materials through its defined reactivity and structural properties.
CAS Number | 20969-02-2 |
Molecular Formula | C7H14ClN |
Purity | ≥95% |
IUPAC Name | 3-azabicyclo[3.2.1]octane;hydrochloride |
InChI | InChI=1S/C7H13N.ClH/c1-2-7-3-6(1)4-8-5-7;/h6-8H,1-5H2;1H |
InChIKey | LYOOHTXASHKGPV-UHFFFAOYSA-N |
SMILES | C1CC2CC1CNC2.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |